C27H35N5O — CID 146475702
N-(3-aminopropyl)-4-[4-(3-piperidin-1-ylpropylamino)quinolin-2-yl]benzamide (PubChem CID 146475702) has the molecular formula C27H35N5O and a molecular weight of 445.61 g/mol. Its IUPAC name is N-(3-aminopropyl)-4-[4-(3-piperidin-1-ylpropylamino)quinolin-2-yl]benzamide.
| Compound Name | N-(3-aminopropyl)-4-[4-(3-piperidin-1-ylpropylamino)quinolin-2-yl]benzamide |
|---|---|
| PubChem CID | 146475702 |
| Molecular Formula | C27H35N5O |
| Molecular Weight | 445.61 g/mol |
| Exact Mass | 445.28 |
| IUPAC Name | N-(3-aminopropyl)-4-[4-(3-piperidin-1-ylpropylamino)quinolin-2-yl]benzamide |
| SMILES | NCCCNC(=O)c1ccc(-c2cc(NCCCN3CCCCC3)c3ccccc3n2)cc1 |
| InChI | InChI=1S/C27H35N5O/c28-14-6-15-30-27(33)22-12-10-21(11-13-22)25-20-26(23-8-2-3-9-24(23)31-25)29-16-7-19-32-17-4-1-5-18-32/h2-3,8-13,20H,1,4-7,14-19,28H2,(H,29,31)(H,30,33) |
| InChIKey | LCMWNPHZDQHGTI-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 83.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.61 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|