C22H27Cl2N3 — CID 45050904
2-phenyl-N-(2-piperidin-1-ylethyl)quinolin-4-amine;dihydrochloride (PubChem CID 45050904) has the molecular formula C22H27Cl2N3 and a molecular weight of 404.39 g/mol. Its IUPAC name is 2-phenyl-N-(2-piperidin-1-ylethyl)quinolin-4-amine;dihydrochloride.
| Compound Name | 2-phenyl-N-(2-piperidin-1-ylethyl)quinolin-4-amine;dihydrochloride |
|---|---|
| PubChem CID | 45050904 |
| Molecular Formula | C22H27Cl2N3 |
| Molecular Weight | 404.39 g/mol |
| Exact Mass | 403.16 |
| IUPAC Name | 2-phenyl-N-(2-piperidin-1-ylethyl)quinolin-4-amine;dihydrochloride |
| SMILES | Cl.Cl.c1ccc(-c2cc(NCCN3CCCCC3)c3ccccc3n2)cc1 |
| InChI | InChI=1S/C22H25N3.2ClH/c1-3-9-18(10-4-1)21-17-22(19-11-5-6-12-20(19)24-21)23-13-16-25-14-7-2-8-15-25;;/h1,3-6,9-12,17H,2,7-8,13-16H2,(H,23,24);2*1H |
| InChIKey | XLBUMYIRYRCFEA-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.39 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |