C17H17ClN2O — CID 18432992
2-[(2-phenylquinolin-4-yl)amino]ethanol;hydrochloride (PubChem CID 18432992) has the molecular formula C17H17ClN2O and a molecular weight of 300.79 g/mol. Its IUPAC name is 2-[(2-phenylquinolin-4-yl)amino]ethanol;hydrochloride.
| Compound Name | 2-[(2-phenylquinolin-4-yl)amino]ethanol;hydrochloride |
|---|---|
| PubChem CID | 18432992 |
| Molecular Formula | C17H17ClN2O |
| Molecular Weight | 300.79 g/mol |
| Exact Mass | 300.10 |
| IUPAC Name | 2-[(2-phenylquinolin-4-yl)amino]ethanol;hydrochloride |
| SMILES | Cl.OCCNc1cc(-c2ccccc2)nc2ccccc12 |
| InChI | InChI=1S/C17H16N2O.ClH/c20-11-10-18-17-12-16(13-6-2-1-3-7-13)19-15-9-5-4-8-14(15)17;/h1-9,12,20H,10-11H2,(H,18,19);1H |
| InChIKey | AKPFVQVQPBWFEP-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.79 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |