C19H21ClN2O3 — CID 18433040
2-[[7-methoxy-2-(4-methoxyphenyl)quinolin-4-yl]amino]ethanol;hydrochloride (PubChem CID 18433040) has the molecular formula C19H21ClN2O3 and a molecular weight of 360.84 g/mol. Its IUPAC name is 2-[[7-methoxy-2-(4-methoxyphenyl)quinolin-4-yl]amino]ethanol;hydrochloride.
| Compound Name | 2-[[7-methoxy-2-(4-methoxyphenyl)quinolin-4-yl]amino]ethanol;hydrochloride |
|---|---|
| PubChem CID | 18433040 |
| Molecular Formula | C19H21ClN2O3 |
| Molecular Weight | 360.84 g/mol |
| Exact Mass | 360.12 |
| IUPAC Name | 2-[[7-methoxy-2-(4-methoxyphenyl)quinolin-4-yl]amino]ethanol;hydrochloride |
| SMILES | COc1ccc(-c2cc(NCCO)c3ccc(OC)cc3n2)cc1.Cl |
| InChI | InChI=1S/C19H20N2O3.ClH/c1-23-14-5-3-13(4-6-14)17-12-18(20-9-10-22)16-8-7-15(24-2)11-19(16)21-17;/h3-8,11-12,22H,9-10H2,1-2H3,(H,20,21);1H |
| InChIKey | OBEMUFMGIAPKDG-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 63.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.84 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |