C25H32N4O2 — CID 175783587
N-[3-[3-[[2-(4-methoxyphenyl)quinolin-4-yl]amino]propyl-methylamino]propyl]acetamide (PubChem CID 175783587) has the molecular formula C25H32N4O2 and a molecular weight of 420.56 g/mol. Its IUPAC name is N-[3-[3-[[2-(4-methoxyphenyl)quinolin-4-yl]amino]propyl-methylamino]propyl]acetamide.
| Compound Name | N-[3-[3-[[2-(4-methoxyphenyl)quinolin-4-yl]amino]propyl-methylamino]propyl]acetamide |
|---|---|
| PubChem CID | 175783587 |
| Molecular Formula | C25H32N4O2 |
| Molecular Weight | 420.56 g/mol |
| Exact Mass | 420.25 |
| IUPAC Name | N-[3-[3-[[2-(4-methoxyphenyl)quinolin-4-yl]amino]propyl-methylamino]propyl]acetamide |
| SMILES | COc1ccc(-c2cc(NCCCN(C)CCCNC(C)=O)c3ccccc3n2)cc1 |
| InChI | InChI=1S/C25H32N4O2/c1-19(30)26-14-6-16-29(2)17-7-15-27-25-18-24(20-10-12-21(31-3)13-11-20)28-23-9-5-4-8-22(23)25/h4-5,8-13,18H,6-7,14-17H2,1-3H3,(H,26,30)(H,27,28) |
| InChIKey | VHVUEHKNISDQFO-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.56 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|