C28H39N5O — CID 172815889
4-(azetidin-3-yl)-3-N-[3-[[2-(4-methoxyphenyl)quinolin-4-yl]amino]propyl]-1-N,1-N-dimethylbutane-1,3-diamine (PubChem CID 172815889) has the molecular formula C28H39N5O and a molecular weight of 461.65 g/mol. Its IUPAC name is 4-(azetidin-3-yl)-3-N-[3-[[2-(4-methoxyphenyl)quinolin-4-yl]amino]propyl]-1-N,1-N-dimethylbutane-1,3-diamine.
| Compound Name | 4-(azetidin-3-yl)-3-N-[3-[[2-(4-methoxyphenyl)quinolin-4-yl]amino]propyl]-1-N,1-N-dimethylbutane-1,3-diamine |
|---|---|
| PubChem CID | 172815889 |
| Molecular Formula | C28H39N5O |
| Molecular Weight | 461.65 g/mol |
| Exact Mass | 461.32 |
| IUPAC Name | 4-(azetidin-3-yl)-3-N-[3-[[2-(4-methoxyphenyl)quinolin-4-yl]amino]propyl]-1-N,1-N-dimethylbutane-1,3-diamine |
| SMILES | COc1ccc(-c2cc(NCCCNC(CCN(C)C)CC3CNC3)c3ccccc3n2)cc1 |
| InChI | InChI=1S/C28H39N5O/c1-33(2)16-13-23(17-21-19-29-20-21)30-14-6-15-31-28-18-27(22-9-11-24(34-3)12-10-22)32-26-8-5-4-7-25(26)28/h4-5,7-12,18,21,23,29-30H,6,13-17,19-20H2,1-3H3,(H,31,32) |
| InChIKey | SUKSBYVXNKRIKN-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 61.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.65 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|