C26H29N3O3 — CID 76556644
tert-butyl 4-[1-(2-phenylethenyl)benzimidazole-2-carbonyl]piperidine-1-carboxylate (PubChem CID 76556644) has the molecular formula C26H29N3O3 and a molecular weight of 431.54 g/mol. Its IUPAC name is tert-butyl 4-[1-(2-phenylethenyl)benzimidazole-2-carbonyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[1-(2-phenylethenyl)benzimidazole-2-carbonyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 76556644 |
| Molecular Formula | C26H29N3O3 |
| Molecular Weight | 431.54 g/mol |
| Exact Mass | 431.22 |
| IUPAC Name | tert-butyl 4-[1-(2-phenylethenyl)benzimidazole-2-carbonyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(C(=O)c2nc3ccccc3n2C=Cc2ccccc2)CC1 |
| InChI | InChI=1S/C26H29N3O3/c1-26(2,3)32-25(31)28-16-14-20(15-17-28)23(30)24-27-21-11-7-8-12-22(21)29(24)18-13-19-9-5-4-6-10-19/h4-13,18,20H,14-17H2,1-3H3 |
| InChIKey | SZBYFFNNWQXCBW-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.54 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |