C27H41N5OSi — CID 69316057
N'-(5,6,7,8-tetrahydroquinolin-8-yl)-N-[[1-(2-trimethylsilylethoxymethyl)benzimidazol-2-yl]methyl]butane-1,4-diamine (PubChem CID 69316057) has the molecular formula C27H41N5OSi and a molecular weight of 479.75 g/mol. Its IUPAC name is N'-(5,6,7,8-tetrahydroquinolin-8-yl)-N-[[1-(2-trimethylsilylethoxymethyl)benzimidazol-2-yl]methyl]butane-1,4-diamine.
| Compound Name | N'-(5,6,7,8-tetrahydroquinolin-8-yl)-N-[[1-(2-trimethylsilylethoxymethyl)benzimidazol-2-yl]methyl]butane-1,4-diamine |
|---|---|
| PubChem CID | 69316057 |
| Molecular Formula | C27H41N5OSi |
| Molecular Weight | 479.75 g/mol |
| Exact Mass | 479.31 |
| IUPAC Name | N'-(5,6,7,8-tetrahydroquinolin-8-yl)-N-[[1-(2-trimethylsilylethoxymethyl)benzimidazol-2-yl]methyl]butane-1,4-diamine |
| SMILES | C[Si](C)(C)CCOCn1c(CNCCCCNC2CCCc3cccnc32)nc2ccccc21 |
| InChI | InChI=1S/C27H41N5OSi/c1-34(2,3)19-18-33-21-32-25-14-5-4-12-23(25)31-26(32)20-28-15-6-7-16-29-24-13-8-10-22-11-9-17-30-27(22)24/h4-5,9,11-12,14,17,24,28-29H,6-8,10,13,15-16,18-21H2,1-3H3 |
| InChIKey | ZTLAETCNNBXZKP-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 64.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.75 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|