C36H44N6OSi — CID 68898838
N-[[4-[(pyridin-2-ylamino)methyl]phenyl]methyl]-N-[[1-(2-trimethylsilylethoxymethyl)benzimidazol-2-yl]methyl]-5,6,7,8-tetrahydroquinolin-8-amine (PubChem CID 68898838) has the molecular formula C36H44N6OSi and a molecular weight of 604.88 g/mol. Its IUPAC name is N-[[4-[(pyridin-2-ylamino)methyl]phenyl]methyl]-N-[[1-(2-trimethylsilylethoxymethyl)benzimidazol-2-yl]methyl]-5,6,7,8-tetrahydroquinolin-8-amine.
| Compound Name | N-[[4-[(pyridin-2-ylamino)methyl]phenyl]methyl]-N-[[1-(2-trimethylsilylethoxymethyl)benzimidazol-2-yl]methyl]-5,6,7,8-tetrahydroquinolin-8-amine |
|---|---|
| PubChem CID | 68898838 |
| Molecular Formula | C36H44N6OSi |
| Molecular Weight | 604.88 g/mol |
| Exact Mass | 604.33 |
| IUPAC Name | N-[[4-[(pyridin-2-ylamino)methyl]phenyl]methyl]-N-[[1-(2-trimethylsilylethoxymethyl)benzimidazol-2-yl]methyl]-5,6,7,8-tetrahydroquinolin-8-amine |
| SMILES | C[Si](C)(C)CCOCn1c(CN(Cc2ccc(CNc3ccccn3)cc2)C2CCCc3cccnc32)nc2ccccc21 |
| InChI | InChI=1S/C36H44N6OSi/c1-44(2,3)23-22-43-27-42-32-13-5-4-12-31(32)40-35(42)26-41(33-14-8-10-30-11-9-21-38-36(30)33)25-29-18-16-28(17-19-29)24-39-34-15-6-7-20-37-34/h4-7,9,11-13,15-21,33H,8,10,14,22-27H2,1-3H3,(H,37,39) |
| InChIKey | CTYZWOMFBNFPBA-UHFFFAOYSA-N |
| XLogP | 7.83 |
| TPSA | 68.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.88 |
| LogP ≤ 5 | 7.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|