C19H34N2O3Si2 — CID 175440411
trimethyl-[2-[[1-oxido-3-(2-trimethylsilylethoxymethyl)benzimidazol-1-ium-2-yl]methoxy]ethyl]silane (PubChem CID 175440411) has the molecular formula C19H34N2O3Si2 and a molecular weight of 394.66 g/mol. Its IUPAC name is trimethyl-[2-[[1-oxido-3-(2-trimethylsilylethoxymethyl)benzimidazol-1-ium-2-yl]methoxy]ethyl]silane.
| Compound Name | trimethyl-[2-[[1-oxido-3-(2-trimethylsilylethoxymethyl)benzimidazol-1-ium-2-yl]methoxy]ethyl]silane |
|---|---|
| PubChem CID | 175440411 |
| Molecular Formula | C19H34N2O3Si2 |
| Molecular Weight | 394.66 g/mol |
| Exact Mass | 394.21 |
| IUPAC Name | trimethyl-[2-[[1-oxido-3-(2-trimethylsilylethoxymethyl)benzimidazol-1-ium-2-yl]methoxy]ethyl]silane |
| SMILES | C[Si](C)(C)CCOCc1n(COCC[Si](C)(C)C)c2ccccc2[n+]1[O-] |
| InChI | InChI=1S/C19H34N2O3Si2/c1-25(2,3)13-11-23-15-19-20(16-24-12-14-26(4,5)6)17-9-7-8-10-18(17)21(19)22/h7-10H,11-16H2,1-6H3 |
| InChIKey | AZWUZBQXQFJCFI-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 50.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.66 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|