C26H31Cl2NO3Si — CID 90419437
[1-[4-[2,6-dichloro-1-(2-trimethylsilylethoxymethyl)indol-5-yl]phenyl]cyclopropyl]methyl acetate (PubChem CID 90419437) has the molecular formula C26H31Cl2NO3Si and a molecular weight of 504.53 g/mol. Its IUPAC name is [1-[4-[2,6-dichloro-1-(2-trimethylsilylethoxymethyl)indol-5-yl]phenyl]cyclopropyl]methyl acetate.
| Compound Name | [1-[4-[2,6-dichloro-1-(2-trimethylsilylethoxymethyl)indol-5-yl]phenyl]cyclopropyl]methyl acetate |
|---|---|
| PubChem CID | 90419437 |
| Molecular Formula | C26H31Cl2NO3Si |
| Molecular Weight | 504.53 g/mol |
| Exact Mass | 503.15 |
| IUPAC Name | [1-[4-[2,6-dichloro-1-(2-trimethylsilylethoxymethyl)indol-5-yl]phenyl]cyclopropyl]methyl acetate |
| SMILES | CC(=O)OCC1(c2ccc(-c3cc4cc(Cl)n(COCC[Si](C)(C)C)c4cc3Cl)cc2)CC1 |
| InChI | InChI=1S/C26H31Cl2NO3Si/c1-18(30)32-16-26(9-10-26)21-7-5-19(6-8-21)22-13-20-14-25(28)29(24(20)15-23(22)27)17-31-11-12-33(2,3)4/h5-8,13-15H,9-12,16-17H2,1-4H3 |
| InChIKey | GBYPFCSPGCWCRP-UHFFFAOYSA-N |
| XLogP | 7.52 |
| TPSA | 40.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.53 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|