C31H39ClN2O4Si — CID 162031918
1-[4-[4-[6-chloro-2-[(3S)-oxolan-3-yl]oxy-1-(2-trimethylsilylethoxymethyl)pyrrolo[3,2-b]pyridin-5-yl]phenyl]cyclohex-3-en-1-yl]ethanone (PubChem CID 162031918) has the molecular formula C31H39ClN2O4Si and a molecular weight of 567.20 g/mol. Its IUPAC name is 1-[4-[4-[6-chloro-2-[(3S)-oxolan-3-yl]oxy-1-(2-trimethylsilylethoxymethyl)pyrrolo[3,2-b]pyridin-5-yl]phenyl]cyclohex-3-en-1-yl]ethanone.
| Compound Name | 1-[4-[4-[6-chloro-2-[(3S)-oxolan-3-yl]oxy-1-(2-trimethylsilylethoxymethyl)pyrrolo[3,2-b]pyridin-5-yl]phenyl]cyclohex-3-en-1-yl]ethanone |
|---|---|
| PubChem CID | 162031918 |
| Molecular Formula | C31H39ClN2O4Si |
| Molecular Weight | 567.20 g/mol |
| Exact Mass | 566.24 |
| IUPAC Name | 1-[4-[4-[6-chloro-2-[(3S)-oxolan-3-yl]oxy-1-(2-trimethylsilylethoxymethyl)pyrrolo[3,2-b]pyridin-5-yl]phenyl]cyclohex-3-en-1-yl]ethanone |
| SMILES | CC(=O)C1CC=C(c2ccc(-c3nc4cc(O[C@H]5CCOC5)n(COCC[Si](C)(C)C)c4cc3Cl)cc2)CC1 |
| InChI | InChI=1S/C31H39ClN2O4Si/c1-21(35)22-5-7-23(8-6-22)24-9-11-25(12-10-24)31-27(32)17-29-28(33-31)18-30(38-26-13-14-36-19-26)34(29)20-37-15-16-39(2,3)4/h7,9-12,17-18,22,26H,5-6,8,13-16,19-20H2,1-4H3/t22?,26-/m0/s1 |
| InChIKey | KITDUNQRRNHLJX-XGCAABAXSA-N |
| XLogP | 7.61 |
| TPSA | 62.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.20 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|