C17H22BrCl2NO3Si — CID 152642755
3-(2-bromoethyl)-4,6-dichloro-1-(2-trimethylsilylethoxymethyl)indole-2-carboxylic acid (PubChem CID 152642755) has the molecular formula C17H22BrCl2NO3Si and a molecular weight of 467.26 g/mol. Its IUPAC name is 3-(2-bromoethyl)-4,6-dichloro-1-(2-trimethylsilylethoxymethyl)indole-2-carboxylic acid.
| Compound Name | 3-(2-bromoethyl)-4,6-dichloro-1-(2-trimethylsilylethoxymethyl)indole-2-carboxylic acid |
|---|---|
| PubChem CID | 152642755 |
| Molecular Formula | C17H22BrCl2NO3Si |
| Molecular Weight | 467.26 g/mol |
| Exact Mass | 464.99 |
| IUPAC Name | 3-(2-bromoethyl)-4,6-dichloro-1-(2-trimethylsilylethoxymethyl)indole-2-carboxylic acid |
| SMILES | C[Si](C)(C)CCOCn1c(C(=O)O)c(CCBr)c2c(Cl)cc(Cl)cc21 |
| InChI | InChI=1S/C17H22BrCl2NO3Si/c1-25(2,3)7-6-24-10-21-14-9-11(19)8-13(20)15(14)12(4-5-18)16(21)17(22)23/h8-9H,4-7,10H2,1-3H3,(H,22,23) |
| InChIKey | ZFXITANUDVGILB-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 51.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.26 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|