C25H38ClN5O4Si — CID 154681113
tert-butyl N-[2-[2-chloro-4-(furan-2-ylmethylamino)-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-6-yl]ethyl]-N-methylcarbamate (PubChem CID 154681113) has the molecular formula C25H38ClN5O4Si and a molecular weight of 536.15 g/mol. Its IUPAC name is tert-butyl N-[2-[2-chloro-4-(furan-2-ylmethylamino)-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-6-yl]ethyl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[2-[2-chloro-4-(furan-2-ylmethylamino)-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-6-yl]ethyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 154681113 |
| Molecular Formula | C25H38ClN5O4Si |
| Molecular Weight | 536.15 g/mol |
| Exact Mass | 535.24 |
| IUPAC Name | tert-butyl N-[2-[2-chloro-4-(furan-2-ylmethylamino)-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-6-yl]ethyl]-N-methylcarbamate |
| SMILES | CN(CCc1cc2c(NCc3ccco3)nc(Cl)nc2n1COCC[Si](C)(C)C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C25H38ClN5O4Si/c1-25(2,3)35-24(32)30(4)11-10-18-15-20-21(27-16-19-9-8-12-34-19)28-23(26)29-22(20)31(18)17-33-13-14-36(5,6)7/h8-9,12,15H,10-11,13-14,16-17H2,1-7H3,(H,27,28,29) |
| InChIKey | LPVRZACNZHMSKT-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 94.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.15 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|