C26H35F2N5O5SSi — CID 175339965
3-[[5-[4-fluoro-2-(2-fluoro-4-pyridinyl)-6-propan-2-ylanilino]-1-(2-trimethylsilylethoxymethyl)-1,2,4-triazol-3-yl]sulfonyl]-2-methylpropanoic acid (PubChem CID 175339965) has the molecular formula C26H35F2N5O5SSi and a molecular weight of 595.75 g/mol. Its IUPAC name is 3-[[5-[4-fluoro-2-(2-fluoro-4-pyridinyl)-6-propan-2-ylanilino]-1-(2-trimethylsilylethoxymethyl)-1,2,4-triazol-3-yl]sulfonyl]-2-methylpropanoic acid.
| Compound Name | 3-[[5-[4-fluoro-2-(2-fluoro-4-pyridinyl)-6-propan-2-ylanilino]-1-(2-trimethylsilylethoxymethyl)-1,2,4-triazol-3-yl]sulfonyl]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 175339965 |
| Molecular Formula | C26H35F2N5O5SSi |
| Molecular Weight | 595.75 g/mol |
| Exact Mass | 595.21 |
| IUPAC Name | 3-[[5-[4-fluoro-2-(2-fluoro-4-pyridinyl)-6-propan-2-ylanilino]-1-(2-trimethylsilylethoxymethyl)-1,2,4-triazol-3-yl]sulfonyl]-2-methylpropanoic acid |
| SMILES | CC(CS(=O)(=O)c1nc(Nc2c(-c3ccnc(F)c3)cc(F)cc2C(C)C)n(COCC[Si](C)(C)C)n1)C(=O)O |
| InChI | InChI=1S/C26H35F2N5O5SSi/c1-16(2)20-12-19(27)13-21(18-7-8-29-22(28)11-18)23(20)30-25-31-26(39(36,37)14-17(3)24(34)35)32-33(25)15-38-9-10-40(4,5)6/h7-8,11-13,16-17H,9-10,14-15H2,1-6H3,(H,34,35)(H,30,31,32) |
| InChIKey | KBHBNLTXDINZFC-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 136.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.75 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|