C29H41N5O3SSi — CID 162462252
5-[[3-(dimethylamino)phenyl]methylsulfonyl]-N-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)-2-(2-trimethylsilylethoxymethyl)-1,2,4-triazol-3-amine (PubChem CID 162462252) has the molecular formula C29H41N5O3SSi and a molecular weight of 567.83 g/mol. Its IUPAC name is 5-[[3-(dimethylamino)phenyl]methylsulfonyl]-N-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)-2-(2-trimethylsilylethoxymethyl)-1,2,4-triazol-3-amine.
| Compound Name | 5-[[3-(dimethylamino)phenyl]methylsulfonyl]-N-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)-2-(2-trimethylsilylethoxymethyl)-1,2,4-triazol-3-amine |
|---|---|
| PubChem CID | 162462252 |
| Molecular Formula | C29H41N5O3SSi |
| Molecular Weight | 567.83 g/mol |
| Exact Mass | 567.27 |
| IUPAC Name | 5-[[3-(dimethylamino)phenyl]methylsulfonyl]-N-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)-2-(2-trimethylsilylethoxymethyl)-1,2,4-triazol-3-amine |
| SMILES | CN(C)c1cccc(CS(=O)(=O)c2nc(Nc3c4c(cc5c3CCC5)CCC4)n(COCC[Si](C)(C)C)n2)c1 |
| InChI | InChI=1S/C29H41N5O3SSi/c1-33(2)24-12-6-9-21(17-24)19-38(35,36)29-31-28(34(32-29)20-37-15-16-39(3,4)5)30-27-25-13-7-10-22(25)18-23-11-8-14-26(23)27/h6,9,12,17-18H,7-8,10-11,13-16,19-20H2,1-5H3,(H,30,31,32) |
| InChIKey | XINKZHOXONNMPA-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 89.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.83 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|