C12H19NO — CID 142585590
3-(2-ethoxyethyl)-N,N-dimethylaniline (PubChem CID 142585590) has the molecular formula C12H19NO and a molecular weight of 193.29 g/mol. Its IUPAC name is 3-(2-ethoxyethyl)-N,N-dimethylaniline.
| Compound Name | 3-(2-ethoxyethyl)-N,N-dimethylaniline |
|---|---|
| PubChem CID | 142585590 |
| Molecular Formula | C12H19NO |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.15 |
| IUPAC Name | 3-(2-ethoxyethyl)-N,N-dimethylaniline |
| SMILES | CCOCCc1cccc(N(C)C)c1 |
| InChI | InChI=1S/C12H19NO/c1-4-14-9-8-11-6-5-7-12(10-11)13(2)3/h5-7,10H,4,8-9H2,1-3H3 |
| InChIKey | VBOUSNPQKXQBAA-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|