C13H22N2O — CID 82353951
3-[2-(ethylamino)ethoxymethyl]-N,N-dimethylaniline (PubChem CID 82353951) has the molecular formula C13H22N2O and a molecular weight of 222.33 g/mol. Its IUPAC name is 3-[2-(ethylamino)ethoxymethyl]-N,N-dimethylaniline.
| Compound Name | 3-[2-(ethylamino)ethoxymethyl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 82353951 |
| Molecular Formula | C13H22N2O |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.17 |
| IUPAC Name | 3-[2-(ethylamino)ethoxymethyl]-N,N-dimethylaniline |
| SMILES | CCNCCOCc1cccc(N(C)C)c1 |
| InChI | InChI=1S/C13H22N2O/c1-4-14-8-9-16-11-12-6-5-7-13(10-12)15(2)3/h5-7,10,14H,4,8-9,11H2,1-3H3 |
| InChIKey | OLYNHIXCJPASBI-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|