C23H29BrFN5OSi — CID 166071440
5-bromo-N-[5-(2-fluoro-4-pyridinyl)-6-methyl-2,3-dihydro-1H-inden-4-yl]-2-(2-trimethylsilylethoxymethyl)-1,2,4-triazol-3-amine (PubChem CID 166071440) has the molecular formula C23H29BrFN5OSi and a molecular weight of 518.51 g/mol. Its IUPAC name is 5-bromo-N-[5-(2-fluoro-4-pyridinyl)-6-methyl-2,3-dihydro-1H-inden-4-yl]-2-(2-trimethylsilylethoxymethyl)-1,2,4-triazol-3-amine.
| Compound Name | 5-bromo-N-[5-(2-fluoro-4-pyridinyl)-6-methyl-2,3-dihydro-1H-inden-4-yl]-2-(2-trimethylsilylethoxymethyl)-1,2,4-triazol-3-amine |
|---|---|
| PubChem CID | 166071440 |
| Molecular Formula | C23H29BrFN5OSi |
| Molecular Weight | 518.51 g/mol |
| Exact Mass | 517.13 |
| IUPAC Name | 5-bromo-N-[5-(2-fluoro-4-pyridinyl)-6-methyl-2,3-dihydro-1H-inden-4-yl]-2-(2-trimethylsilylethoxymethyl)-1,2,4-triazol-3-amine |
| SMILES | Cc1cc2c(c(Nc3nc(Br)nn3COCC[Si](C)(C)C)c1-c1ccnc(F)c1)CCC2 |
| InChI | InChI=1S/C23H29BrFN5OSi/c1-15-12-16-6-5-7-18(16)21(20(15)17-8-9-26-19(25)13-17)27-23-28-22(24)29-30(23)14-31-10-11-32(2,3)4/h8-9,12-13H,5-7,10-11,14H2,1-4H3,(H,27,28,29) |
| InChIKey | QWWXWOVTDUBZIS-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 64.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.51 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|