C25H38N4O2SSi — CID 153357076
N-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)-5-(oxan-4-ylsulfanyl)-2-(2-trimethylsilylethoxymethyl)-1,2,4-triazol-3-amine (PubChem CID 153357076) has the molecular formula C25H38N4O2SSi and a molecular weight of 486.76 g/mol. Its IUPAC name is N-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)-5-(oxan-4-ylsulfanyl)-2-(2-trimethylsilylethoxymethyl)-1,2,4-triazol-3-amine.
| Compound Name | N-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)-5-(oxan-4-ylsulfanyl)-2-(2-trimethylsilylethoxymethyl)-1,2,4-triazol-3-amine |
|---|---|
| PubChem CID | 153357076 |
| Molecular Formula | C25H38N4O2SSi |
| Molecular Weight | 486.76 g/mol |
| Exact Mass | 486.25 |
| IUPAC Name | N-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)-5-(oxan-4-ylsulfanyl)-2-(2-trimethylsilylethoxymethyl)-1,2,4-triazol-3-amine |
| SMILES | C[Si](C)(C)CCOCn1nc(SC2CCOCC2)nc1Nc1c2c(cc3c1CCC3)CCC2 |
| InChI | InChI=1S/C25H38N4O2SSi/c1-33(2,3)15-14-31-17-29-24(27-25(28-29)32-20-10-12-30-13-11-20)26-23-21-8-4-6-18(21)16-19-7-5-9-22(19)23/h16,20H,4-15,17H2,1-3H3,(H,26,27,28) |
| InChIKey | BJEHUGJHZONWET-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 61.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.76 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|