C14H14ClFN4OS2 — CID 153357271
[3-chlorosulfinyl-5-(1,2,3,5,6,7-hexahydro-s-indacen-4-ylamino)-1,2,4-triazol-1-yl] thiohypofluorite (PubChem CID 153357271) has the molecular formula C14H14ClFN4OS2 and a molecular weight of 372.88 g/mol. Its IUPAC name is [3-chlorosulfinyl-5-(1,2,3,5,6,7-hexahydro-s-indacen-4-ylamino)-1,2,4-triazol-1-yl] thiohypofluorite.
| Compound Name | [3-chlorosulfinyl-5-(1,2,3,5,6,7-hexahydro-s-indacen-4-ylamino)-1,2,4-triazol-1-yl] thiohypofluorite |
|---|---|
| PubChem CID | 153357271 |
| Molecular Formula | C14H14ClFN4OS2 |
| Molecular Weight | 372.88 g/mol |
| Exact Mass | 372.03 |
| IUPAC Name | [3-chlorosulfinyl-5-(1,2,3,5,6,7-hexahydro-s-indacen-4-ylamino)-1,2,4-triazol-1-yl] thiohypofluorite |
| SMILES | O=S(Cl)c1nc(Nc2c3c(cc4c2CCC4)CCC3)n(SF)n1 |
| InChI | InChI=1S/C14H14ClFN4OS2/c15-23(21)14-18-13(20(19-14)22-16)17-12-10-5-1-3-8(10)7-9-4-2-6-11(9)12/h7H,1-6H2,(H,17,18,19) |
| InChIKey | GIMBYOWTVQWZSD-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.88 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |