C14H14FN4NaO2S2 — CID 153357323
sodium 1-fluorosulfanyl-5-(1,2,3,5,6,7-hexahydro-s-indacen-4-ylamino)-1,2,4-triazole-3-sulfinate (PubChem CID 153357323) has the molecular formula C14H14FN4NaO2S2 and a molecular weight of 376.41 g/mol. Its IUPAC name is sodium 1-fluorosulfanyl-5-(1,2,3,5,6,7-hexahydro-s-indacen-4-ylamino)-1,2,4-triazole-3-sulfinate.
| Compound Name | sodium 1-fluorosulfanyl-5-(1,2,3,5,6,7-hexahydro-s-indacen-4-ylamino)-1,2,4-triazole-3-sulfinate |
|---|---|
| PubChem CID | 153357323 |
| Molecular Formula | C14H14FN4NaO2S2 |
| Molecular Weight | 376.41 g/mol |
| Exact Mass | 376.04 |
| IUPAC Name | sodium 1-fluorosulfanyl-5-(1,2,3,5,6,7-hexahydro-s-indacen-4-ylamino)-1,2,4-triazole-3-sulfinate |
| SMILES | O=S([O-])c1nc(Nc2c3c(cc4c2CCC4)CCC3)n(SF)n1.[Na+] |
| InChI | InChI=1S/C14H15FN4O2S2.Na/c15-22-19-13(17-14(18-19)23(20)21)16-12-10-5-1-3-8(10)7-9-4-2-6-11(9)12;/h7H,1-6H2,(H,20,21)(H,16,17,18);/q;+1/p-1 |
| InChIKey | UUFITVBRNWOKTG-UHFFFAOYSA-M |
| XLogP | -0.38 |
| TPSA | 82.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.41 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|