C14H16BN — CID 174088147
CID 174088147 (PubChem CID 174088147) has the molecular formula C14H16BN and a molecular weight of 209.10 g/mol.
| Compound Name | CID 174088147 |
|---|---|
| PubChem CID | 174088147 |
| Molecular Formula | C14H16BN |
| Molecular Weight | 209.10 g/mol |
| Exact Mass | 209.14 |
| IUPAC Name | — |
| SMILES | [B]C(=C)Nc1c2c(cc3c1CCC3)CCC2 |
| InChI | InChI=1S/C14H16BN/c1-9(15)16-14-12-6-2-4-10(12)8-11-5-3-7-13(11)14/h8,16H,1-7H2 |
| InChIKey | KUCQOJHFQKRDFY-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.10 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|