C13H14N2O2S — CID 146515062
1-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)-3-sulfinylurea (PubChem CID 146515062) has the molecular formula C13H14N2O2S and a molecular weight of 262.33 g/mol. Its IUPAC name is 1-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)-3-sulfinylurea.
| Compound Name | 1-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)-3-sulfinylurea |
|---|---|
| PubChem CID | 146515062 |
| Molecular Formula | C13H14N2O2S |
| Molecular Weight | 262.33 g/mol |
| Exact Mass | 262.08 |
| IUPAC Name | 1-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)-3-sulfinylurea |
| SMILES | O=S=NC(=O)Nc1c2c(cc3c1CCC3)CCC2 |
| InChI | InChI=1S/C13H14N2O2S/c16-13(15-18-17)14-12-10-5-1-3-8(10)7-9-4-2-6-11(9)12/h7H,1-6H2,(H,14,16) |
| InChIKey | DIRUSRMLNWDUAJ-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.33 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |