C19H27N5O2S — CID 146610602
1-[amino-oxo-(2-propan-2-yl-1,5-dihydropyrazol-5-yl)-λ6-sulfanylidene]-3-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)urea (PubChem CID 146610602) has the molecular formula C19H27N5O2S and a molecular weight of 389.53 g/mol. Its IUPAC name is 1-[amino-oxo-(2-propan-2-yl-1,5-dihydropyrazol-5-yl)-λ6-sulfanylidene]-3-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)urea.
| Compound Name | 1-[amino-oxo-(2-propan-2-yl-1,5-dihydropyrazol-5-yl)-λ6-sulfanylidene]-3-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)urea |
|---|---|
| PubChem CID | 146610602 |
| Molecular Formula | C19H27N5O2S |
| Molecular Weight | 389.53 g/mol |
| Exact Mass | 389.19 |
| IUPAC Name | 1-[amino-oxo-(2-propan-2-yl-1,5-dihydropyrazol-5-yl)-λ6-sulfanylidene]-3-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)urea |
| SMILES | CC(C)N1C=CC(S(N)(=O)=NC(=O)Nc2c3c(cc4c2CCC4)CCC3)N1 |
| InChI | InChI=1S/C19H27N5O2S/c1-12(2)24-10-9-17(22-24)27(20,26)23-19(25)21-18-15-7-3-5-13(15)11-14-6-4-8-16(14)18/h9-12,17,22H,3-8H2,1-2H3,(H3,20,21,23,25,26) |
| InChIKey | JMPYCTYSVULISV-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 99.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.53 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |