C20H29N4O2S- — CID 137453163
CID 137453163 (PubChem CID 137453163) has the molecular formula C20H29N4O2S- and a molecular weight of 389.55 g/mol.
| Compound Name | CID 137453163 |
|---|---|
| PubChem CID | 137453163 |
| Molecular Formula | C20H29N4O2S- |
| Molecular Weight | 389.55 g/mol |
| Exact Mass | 389.20 |
| IUPAC Name | — |
| SMILES | CC(C)N1CCC(/[S-](=O)=N/C(=O)Nc2c3c(cc4c2CCC4)CCC3)N1C |
| InChI | InChI=1S/C20H29N4O2S/c1-13(2)24-11-10-18(23(24)3)27(26)22-20(25)21-19-16-8-4-6-14(16)12-15-7-5-9-17(15)19/h12-13,18H,4-11H2,1-3H3,(H,21,25)/q-1 |
| InChIKey | GNFCGRSJXMJHFW-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 65.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.55 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|