C21H24N3O2S2- — CID 146610656
CID 146610656 (PubChem CID 146610656) has the molecular formula C21H24N3O2S2- and a molecular weight of 414.58 g/mol.
| Compound Name | CID 146610656 |
|---|---|
| PubChem CID | 146610656 |
| Molecular Formula | C21H24N3O2S2- |
| Molecular Weight | 414.58 g/mol |
| Exact Mass | 414.13 |
| IUPAC Name | — |
| SMILES | CN1CCc2cc(/[S-](=O)=N/C(=O)Nc3c4c(cc5c3CCC5)CCC4)sc2C1 |
| InChI | InChI=1S/C21H24N3O2S2/c1-24-9-8-15-11-19(27-18(15)12-24)28(26)23-21(25)22-20-16-6-2-4-13(16)10-14-5-3-7-17(14)20/h10-11H,2-9,12H2,1H3,(H,22,25)/q-1 |
| InChIKey | VTTZYYJANGZMCY-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.58 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|