C20H23N4O3S- — CID 168751064
CID 168751064 (PubChem CID 168751064) has the molecular formula C20H23N4O3S- and a molecular weight of 399.50 g/mol.
| Compound Name | CID 168751064 |
|---|---|
| PubChem CID | 168751064 |
| Molecular Formula | C20H23N4O3S- |
| Molecular Weight | 399.50 g/mol |
| Exact Mass | 399.15 |
| IUPAC Name | — |
| SMILES | CC1(C)COc2c(/[S-](=O)=N/C(=O)Nc3c4c(cc5c3CC5)CCC4)cnn2C1 |
| InChI | InChI=1S/C20H23N4O3S/c1-20(2)10-24-18(27-11-20)16(9-21-24)28(26)23-19(25)22-17-14-5-3-4-12(14)8-13-6-7-15(13)17/h8-9H,3-7,10-11H2,1-2H3,(H,22,25)/q-1 |
| InChIKey | SNPQFDDDLMNHET-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 85.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.50 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|