C19H23N5O3S — CID 146610963
1-[amino-(6,6-dimethyl-5,7-dihydropyrazolo[5,1-b][1,3]oxazin-3-yl)-oxo-λ6-sulfanylidene]-3-(2-tricyclo[6.2.0.03,6]deca-1(8),2,6-trienyl)urea (PubChem CID 146610963) has the molecular formula C19H23N5O3S and a molecular weight of 401.49 g/mol. Its IUPAC name is 1-[amino-(6,6-dimethyl-5,7-dihydropyrazolo[5,1-b][1,3]oxazin-3-yl)-oxo-λ6-sulfanylidene]-3-(2-tricyclo[6.2.0.03,6]deca-1(8),2,6-trienyl)urea.
| Compound Name | 1-[amino-(6,6-dimethyl-5,7-dihydropyrazolo[5,1-b][1,3]oxazin-3-yl)-oxo-λ6-sulfanylidene]-3-(2-tricyclo[6.2.0.03,6]deca-1(8),2,6-trienyl)urea |
|---|---|
| PubChem CID | 146610963 |
| Molecular Formula | C19H23N5O3S |
| Molecular Weight | 401.49 g/mol |
| Exact Mass | 401.15 |
| IUPAC Name | 1-[amino-(6,6-dimethyl-5,7-dihydropyrazolo[5,1-b][1,3]oxazin-3-yl)-oxo-λ6-sulfanylidene]-3-(2-tricyclo[6.2.0.03,6]deca-1(8),2,6-trienyl)urea |
| SMILES | CC1(C)COc2c(S(N)(=O)=NC(=O)Nc3c4c(cc5c3CC5)CC4)cnn2C1 |
| InChI | InChI=1S/C19H23N5O3S/c1-19(2)9-24-17(27-10-19)15(8-21-24)28(20,26)23-18(25)22-16-13-5-3-11(13)7-12-4-6-14(12)16/h7-8H,3-6,9-10H2,1-2H3,(H3,20,22,23,25,26) |
| InChIKey | KSBADPVVNFWGOF-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 111.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.49 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |