C19H22N3O4S2- — CID 146611191
CID 146611191 (PubChem CID 146611191) has the molecular formula C19H22N3O4S2- and a molecular weight of 420.54 g/mol.
| Compound Name | CID 146611191 |
|---|---|
| PubChem CID | 146611191 |
| Molecular Formula | C19H22N3O4S2- |
| Molecular Weight | 420.54 g/mol |
| Exact Mass | 420.11 |
| IUPAC Name | — |
| SMILES | CC(C)(O)c1cnc(/[S-](=O)=N/C(=O)Nc2c3c(cc4c2CCC4O)CCC3)s1 |
| InChI | InChI=1S/C19H22N3O4S2/c1-19(2,25)15-9-20-18(27-15)28(26)22-17(24)21-16-11-5-3-4-10(11)8-13-12(16)6-7-14(13)23/h8-9,14,23,25H,3-7H2,1-2H3,(H,21,24)/q-1 |
| InChIKey | RIRHPRWBQKYVCL-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 111.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.54 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|