About CID 146611191
CID 146611191 (PubChem CID 146611191) has the molecular formula C19H22N3O4S2-
and a molecular weight of 420.54 g/mol.
Molecular Properties
| Compound Name | CID 146611191 |
| PubChem CID | 146611191 |
| Molecular Formula | C19H22N3O4S2- |
| Molecular Weight | 420.54 g/mol |
| Exact Mass | 420.11 |
| IUPAC Name | — |
| SMILES | CC(C)(O)c1cnc(/[S-](=O)=N/C(=O)Nc2c3c(cc4c2CCC4O)CCC3)s1 |
| InChI | InChI=1S/C19H22N3O4S2/c1-19(2,25)15-9-20-18(27-15)28(26)22-17(24)21-16-11-5-3-4-10(11)8-13-12(16)6-7-14(13)23/h8-9,14,23,25H,3-7H2,1-2H3,(H,21,24)/q-1 |
| InChIKey | RIRHPRWBQKYVCL-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 111.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 420.54 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|
Analyze CID 146611191 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 146611191?
The IUPAC name of CID 146611191 (CID 146611191) is not available.
What is the SMILES notation for CID 146611191?
The canonical SMILES for CID 146611191 is CC(C)(O)c1cnc(/[S-](=O)=N/C(=O)Nc2c3c(cc4c2CCC4O)CCC3)s1.
What is the InChIKey of CID 146611191?
The InChIKey is RIRHPRWBQKYVCL-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H22N3O4S2/c1-19(2,25)15-9-20-18(27-15)28(26)22-17(24)21-16-11-5-3-4-10(11)8-13-12(16)6-7-14(13)23/h8-9,14,23,25H,3-7H2,1-2H3,(H,21,24)/q-1.
What are the key properties of CID 146611191?
CID 146611191 has a molecular weight of 420.54 g/mol, XLogP of 3.58, 3 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for CID 146611191 is sourced from PubChem (CID 146611191), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).