C21H26N3O3S2- — CID 174038236
CID 174038236 (PubChem CID 174038236) has the molecular formula C21H26N3O3S2- and a molecular weight of 432.59 g/mol.
| Compound Name | CID 174038236 |
|---|---|
| PubChem CID | 174038236 |
| Molecular Formula | C21H26N3O3S2- |
| Molecular Weight | 432.59 g/mol |
| Exact Mass | 432.14 |
| IUPAC Name | — |
| SMILES | CC1CCc2c1nc1c(c2NC(=O)/N=[S-](=O)/c2cc(C(C)(C)O)cs2)CCC1C |
| InChI | InChI=1S/C21H26N3O3S2/c1-11-5-7-14-17(11)22-18-12(2)6-8-15(18)19(14)23-20(25)24-29(27)16-9-13(10-28-16)21(3,4)26/h9-12,26H,5-8H2,1-4H3,(H,22,23,25)/q-1 |
| InChIKey | KYIOTJAHIALTHG-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 91.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.59 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|