C22H29N3O2S2 — CID 142522894
(1E)-1-[dimethylamino-[4-(2-hydroxypropan-2-yl)thiophen-2-yl]-λ4-sulfanylidene]-3-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)urea (PubChem CID 142522894) has the molecular formula C22H29N3O2S2 and a molecular weight of 431.63 g/mol. Its IUPAC name is (1E)-1-[dimethylamino-[4-(2-hydroxypropan-2-yl)thiophen-2-yl]-λ4-sulfanylidene]-3-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)urea.
| Compound Name | (1E)-1-[dimethylamino-[4-(2-hydroxypropan-2-yl)thiophen-2-yl]-λ4-sulfanylidene]-3-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)urea |
|---|---|
| PubChem CID | 142522894 |
| Molecular Formula | C22H29N3O2S2 |
| Molecular Weight | 431.63 g/mol |
| Exact Mass | 431.17 |
| IUPAC Name | (1E)-1-[dimethylamino-[4-(2-hydroxypropan-2-yl)thiophen-2-yl]-λ4-sulfanylidene]-3-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)urea |
| SMILES | CN(C)/S(=N/C(=O)Nc1c2c(cc3c1CCC3)CCC2)c1cc(C(C)(C)O)cs1 |
| InChI | InChI=1S/C22H29N3O2S2/c1-22(2,27)16-12-19(28-13-16)29(25(3)4)24-21(26)23-20-17-9-5-7-14(17)11-15-8-6-10-18(15)20/h11-13,27H,5-10H2,1-4H3,(H,23,26) |
| InChIKey | BJSJAWHQQZSSTP-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 64.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.63 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |