C20H29N3O2S2 — CID 154662052
methanamine;2-(5-sulfanylthiophen-3-yl)propan-2-ol;2-tricyclo[6.3.0.03,6]undeca-1,3(6),7-trienylurea (PubChem CID 154662052) has the molecular formula C20H29N3O2S2 and a molecular weight of 407.61 g/mol. Its IUPAC name is methanamine;2-(5-sulfanylthiophen-3-yl)propan-2-ol;2-tricyclo[6.3.0.03,6]undeca-1,3(6),7-trienylurea.
| Compound Name | methanamine;2-(5-sulfanylthiophen-3-yl)propan-2-ol;2-tricyclo[6.3.0.03,6]undeca-1,3(6),7-trienylurea |
|---|---|
| PubChem CID | 154662052 |
| Molecular Formula | C20H29N3O2S2 |
| Molecular Weight | 407.61 g/mol |
| Exact Mass | 407.17 |
| IUPAC Name | methanamine;2-(5-sulfanylthiophen-3-yl)propan-2-ol;2-tricyclo[6.3.0.03,6]undeca-1,3(6),7-trienylurea |
| SMILES | CC(C)(O)c1csc(S)c1.CN.NC(=O)Nc1c2c(cc3c1CC3)CCC2 |
| InChI | InChI=1S/C12H14N2O.C7H10OS2.CH5N/c13-12(15)14-11-9-3-1-2-7(9)6-8-4-5-10(8)11;1-7(2,8)5-3-6(9)10-4-5;1-2/h6H,1-5H2,(H3,13,14,15);3-4,8-9H,1-2H3;2H2,1H3 |
| InChIKey | OGKKIZXHQHUTTD-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 101.37 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.61 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|