C18H22N4O2S2 — CID 142522787
1-(5-aminosulfanyl-1,3-thiazol-2-yl)ethanone;1,2,3,5,6,7-hexahydro-s-indacen-4-ylurea (PubChem CID 142522787) has the molecular formula C18H22N4O2S2 and a molecular weight of 390.53 g/mol. Its IUPAC name is 1-(5-aminosulfanyl-1,3-thiazol-2-yl)ethanone;1,2,3,5,6,7-hexahydro-s-indacen-4-ylurea.
| Compound Name | 1-(5-aminosulfanyl-1,3-thiazol-2-yl)ethanone;1,2,3,5,6,7-hexahydro-s-indacen-4-ylurea |
|---|---|
| PubChem CID | 142522787 |
| Molecular Formula | C18H22N4O2S2 |
| Molecular Weight | 390.53 g/mol |
| Exact Mass | 390.12 |
| IUPAC Name | 1-(5-aminosulfanyl-1,3-thiazol-2-yl)ethanone;1,2,3,5,6,7-hexahydro-s-indacen-4-ylurea |
| SMILES | CC(=O)c1ncc(SN)s1.NC(=O)Nc1c2c(cc3c1CCC3)CCC2 |
| InChI | InChI=1S/C13H16N2O.C5H6N2OS2/c14-13(16)15-12-10-5-1-3-8(10)7-9-4-2-6-11(9)12;1-3(8)5-7-2-4(9-5)10-6/h7H,1-6H2,(H3,14,15,16);2H,6H2,1H3 |
| InChIKey | HLNKVEPCYNZXGO-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 111.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.53 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|