C22H27N3OS — CID 154660326
S-(2,3-dihydro-1H-inden-2-yl)thiohydroxylamine;1,2,3,5,6,7-hexahydro-s-indacen-4-ylurea (PubChem CID 154660326) has the molecular formula C22H27N3OS and a molecular weight of 381.55 g/mol. Its IUPAC name is S-(2,3-dihydro-1H-inden-2-yl)thiohydroxylamine;1,2,3,5,6,7-hexahydro-s-indacen-4-ylurea.
| Compound Name | S-(2,3-dihydro-1H-inden-2-yl)thiohydroxylamine;1,2,3,5,6,7-hexahydro-s-indacen-4-ylurea |
|---|---|
| PubChem CID | 154660326 |
| Molecular Formula | C22H27N3OS |
| Molecular Weight | 381.55 g/mol |
| Exact Mass | 381.19 |
| IUPAC Name | S-(2,3-dihydro-1H-inden-2-yl)thiohydroxylamine;1,2,3,5,6,7-hexahydro-s-indacen-4-ylurea |
| SMILES | NC(=O)Nc1c2c(cc3c1CCC3)CCC2.NSC1Cc2ccccc2C1 |
| InChI | InChI=1S/C13H16N2O.C9H11NS/c14-13(16)15-12-10-5-1-3-8(10)7-9-4-2-6-11(9)12;10-11-9-5-7-3-1-2-4-8(7)6-9/h7H,1-6H2,(H3,14,15,16);1-4,9H,5-6,10H2 |
| InChIKey | OZMJTDWIJGPVOI-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 81.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.55 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|