C23H27N3OS — CID 170372656
1-(4-aminophenyl)sulfanyl-N-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)pyrrolidine-2-carboxamide (PubChem CID 170372656) has the molecular formula C23H27N3OS and a molecular weight of 393.56 g/mol. Its IUPAC name is 1-(4-aminophenyl)sulfanyl-N-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)pyrrolidine-2-carboxamide.
| Compound Name | 1-(4-aminophenyl)sulfanyl-N-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 170372656 |
| Molecular Formula | C23H27N3OS |
| Molecular Weight | 393.56 g/mol |
| Exact Mass | 393.19 |
| IUPAC Name | 1-(4-aminophenyl)sulfanyl-N-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)pyrrolidine-2-carboxamide |
| SMILES | Nc1ccc(SN2CCCC2C(=O)Nc2c3c(cc4c2CCC4)CCC3)cc1 |
| InChI | InChI=1S/C23H27N3OS/c24-17-9-11-18(12-10-17)28-26-13-3-8-21(26)23(27)25-22-19-6-1-4-15(19)14-16-5-2-7-20(16)22/h9-12,14,21H,1-8,13,24H2,(H,25,27) |
| InChIKey | IFOIEJSGSYAEKD-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.56 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|