C21H24N4O2S — CID 142490276
cyanamide;1-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)-3-(4-methoxyphenyl)sulfanylurea (PubChem CID 142490276) has the molecular formula C21H24N4O2S and a molecular weight of 396.52 g/mol. Its IUPAC name is cyanamide;1-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)-3-(4-methoxyphenyl)sulfanylurea.
| Compound Name | cyanamide;1-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)-3-(4-methoxyphenyl)sulfanylurea |
|---|---|
| PubChem CID | 142490276 |
| Molecular Formula | C21H24N4O2S |
| Molecular Weight | 396.52 g/mol |
| Exact Mass | 396.16 |
| IUPAC Name | cyanamide;1-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)-3-(4-methoxyphenyl)sulfanylurea |
| SMILES | COc1ccc(SNC(=O)Nc2c3c(cc4c2CCC4)CCC3)cc1.N#CN |
| InChI | InChI=1S/C20H22N2O2S.CH2N2/c1-24-15-8-10-16(11-9-15)25-22-20(23)21-19-17-6-2-4-13(17)12-14-5-3-7-18(14)19;2-1-3/h8-12H,2-7H2,1H3,(H2,21,22,23);2H2 |
| InChIKey | ZSWMNPWOFLBXOA-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 100.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.52 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|