C22H24N4O2S — CID 155744634
5-cyano-2-formamidosulfanylbenzamide;N-methyl-1,2,3,5,6,7-hexahydro-s-indacen-4-amine (PubChem CID 155744634) has the molecular formula C22H24N4O2S and a molecular weight of 408.53 g/mol. Its IUPAC name is 5-cyano-2-formamidosulfanylbenzamide;N-methyl-1,2,3,5,6,7-hexahydro-s-indacen-4-amine.
| Compound Name | 5-cyano-2-formamidosulfanylbenzamide;N-methyl-1,2,3,5,6,7-hexahydro-s-indacen-4-amine |
|---|---|
| PubChem CID | 155744634 |
| Molecular Formula | C22H24N4O2S |
| Molecular Weight | 408.53 g/mol |
| Exact Mass | 408.16 |
| IUPAC Name | 5-cyano-2-formamidosulfanylbenzamide;N-methyl-1,2,3,5,6,7-hexahydro-s-indacen-4-amine |
| SMILES | CNc1c2c(cc3c1CCC3)CCC2.N#Cc1ccc(SNC=O)c(C(N)=O)c1 |
| InChI | InChI=1S/C13H17N.C9H7N3O2S/c1-14-13-11-6-2-4-9(11)8-10-5-3-7-12(10)13;10-4-6-1-2-8(15-12-5-13)7(3-6)9(11)14/h8,14H,2-7H2,1H3;1-3,5H,(H2,11,14)(H,12,13) |
| InChIKey | OPVANJUSGADVEJ-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 108.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.53 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|