C25H26N2O4 — CID 170188196
ethyl 3-(3-cyanophenyl)-2-(1,2,3,5,6,7-hexahydro-s-indacen-4-ylcarbamoyloxy)propanoate (PubChem CID 170188196) has the molecular formula C25H26N2O4 and a molecular weight of 418.49 g/mol. Its IUPAC name is ethyl 3-(3-cyanophenyl)-2-(1,2,3,5,6,7-hexahydro-s-indacen-4-ylcarbamoyloxy)propanoate.
| Compound Name | ethyl 3-(3-cyanophenyl)-2-(1,2,3,5,6,7-hexahydro-s-indacen-4-ylcarbamoyloxy)propanoate |
|---|---|
| PubChem CID | 170188196 |
| Molecular Formula | C25H26N2O4 |
| Molecular Weight | 418.49 g/mol |
| Exact Mass | 418.19 |
| IUPAC Name | ethyl 3-(3-cyanophenyl)-2-(1,2,3,5,6,7-hexahydro-s-indacen-4-ylcarbamoyloxy)propanoate |
| SMILES | CCOC(=O)C(Cc1cccc(C#N)c1)OC(=O)Nc1c2c(cc3c1CCC3)CCC2 |
| InChI | InChI=1S/C25H26N2O4/c1-2-30-24(28)22(13-16-6-3-7-17(12-16)15-26)31-25(29)27-23-20-10-4-8-18(20)14-19-9-5-11-21(19)23/h3,6-7,12,14,22H,2,4-5,8-11,13H2,1H3,(H,27,29) |
| InChIKey | XMDNSSDODJKSSK-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 88.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.49 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |