C25H31NO4 — CID 177182416
ethyl 4-phenylbutanoate;1,2,3,5,6,7-hexahydro-s-indacen-4-ylcarbamic acid (PubChem CID 177182416) has the molecular formula C25H31NO4 and a molecular weight of 409.53 g/mol. Its IUPAC name is ethyl 4-phenylbutanoate;1,2,3,5,6,7-hexahydro-s-indacen-4-ylcarbamic acid.
| Compound Name | ethyl 4-phenylbutanoate;1,2,3,5,6,7-hexahydro-s-indacen-4-ylcarbamic acid |
|---|---|
| PubChem CID | 177182416 |
| Molecular Formula | C25H31NO4 |
| Molecular Weight | 409.53 g/mol |
| Exact Mass | 409.23 |
| IUPAC Name | ethyl 4-phenylbutanoate;1,2,3,5,6,7-hexahydro-s-indacen-4-ylcarbamic acid |
| SMILES | CCOC(=O)CCCc1ccccc1.O=C(O)Nc1c2c(cc3c1CCC3)CCC2 |
| InChI | InChI=1S/C13H15NO2.C12H16O2/c15-13(16)14-12-10-5-1-3-8(10)7-9-4-2-6-11(9)12;1-2-14-12(13)10-6-9-11-7-4-3-5-8-11/h7,14H,1-6H2,(H,15,16);3-5,7-8H,2,6,9-10H2,1H3 |
| InChIKey | OBQRYPHPBOPXPT-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.53 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |