C20H19N3OS — CID 167062764
1-(3-cyanophenyl)sulfanyl-3-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)urea (PubChem CID 167062764) has the molecular formula C20H19N3OS and a molecular weight of 349.46 g/mol. Its IUPAC name is 1-(3-cyanophenyl)sulfanyl-3-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)urea.
| Compound Name | 1-(3-cyanophenyl)sulfanyl-3-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)urea |
|---|---|
| PubChem CID | 167062764 |
| Molecular Formula | C20H19N3OS |
| Molecular Weight | 349.46 g/mol |
| Exact Mass | 349.12 |
| IUPAC Name | 1-(3-cyanophenyl)sulfanyl-3-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)urea |
| SMILES | N#Cc1cccc(SNC(=O)Nc2c3c(cc4c2CCC4)CCC3)c1 |
| InChI | InChI=1S/C20H19N3OS/c21-12-13-4-1-7-16(10-13)25-23-20(24)22-19-17-8-2-5-14(17)11-15-6-3-9-18(15)19/h1,4,7,10-11H,2-3,5-6,8-9H2,(H2,22,23,24) |
| InChIKey | PHXDKYPWXCFPQR-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 64.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.46 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|