C21H23N3OS — CID 145139672
1-(6,7-dihydro-5H-cyclopenta[b]pyridin-3-ylsulfanyl)-3-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)urea (PubChem CID 145139672) has the molecular formula C21H23N3OS and a molecular weight of 365.50 g/mol. Its IUPAC name is 1-(6,7-dihydro-5H-cyclopenta[b]pyridin-3-ylsulfanyl)-3-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)urea.
| Compound Name | 1-(6,7-dihydro-5H-cyclopenta[b]pyridin-3-ylsulfanyl)-3-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)urea |
|---|---|
| PubChem CID | 145139672 |
| Molecular Formula | C21H23N3OS |
| Molecular Weight | 365.50 g/mol |
| Exact Mass | 365.16 |
| IUPAC Name | 1-(6,7-dihydro-5H-cyclopenta[b]pyridin-3-ylsulfanyl)-3-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)urea |
| SMILES | O=C(NSc1cnc2c(c1)CCC2)Nc1c2c(cc3c1CCC3)CCC2 |
| InChI | InChI=1S/C21H23N3OS/c25-21(24-26-16-11-15-6-3-9-19(15)22-12-16)23-20-17-7-1-4-13(17)10-14-5-2-8-18(14)20/h10-12H,1-9H2,(H2,23,24,25) |
| InChIKey | HFLOPTNBLCBXAD-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.50 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|