C17H17F3N4OS — CID 146269296
1-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)-3-[1-(trifluoromethyl)pyrazol-3-yl]sulfanylurea (PubChem CID 146269296) has the molecular formula C17H17F3N4OS and a molecular weight of 382.41 g/mol. Its IUPAC name is 1-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)-3-[1-(trifluoromethyl)pyrazol-3-yl]sulfanylurea.
| Compound Name | 1-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)-3-[1-(trifluoromethyl)pyrazol-3-yl]sulfanylurea |
|---|---|
| PubChem CID | 146269296 |
| Molecular Formula | C17H17F3N4OS |
| Molecular Weight | 382.41 g/mol |
| Exact Mass | 382.11 |
| IUPAC Name | 1-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)-3-[1-(trifluoromethyl)pyrazol-3-yl]sulfanylurea |
| SMILES | O=C(NSc1ccn(C(F)(F)F)n1)Nc1c2c(cc3c1CCC3)CCC2 |
| InChI | InChI=1S/C17H17F3N4OS/c18-17(19,20)24-8-7-14(22-24)26-23-16(25)21-15-12-5-1-3-10(12)9-11-4-2-6-13(11)15/h7-9H,1-6H2,(H2,21,23,25) |
| InChIKey | VBZKLXILHXEMFN-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.41 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|