C22H29N5O4S — CID 142529476
3-(1,2,3,5,6,7-hexahydro-s-indacen-4-ylcarbamoylamino)sulfanyl-N,N-bis(2-hydroxyethyl)-1-methylpyrazole-5-carboxamide (PubChem CID 142529476) has the molecular formula C22H29N5O4S and a molecular weight of 459.57 g/mol. Its IUPAC name is 3-(1,2,3,5,6,7-hexahydro-s-indacen-4-ylcarbamoylamino)sulfanyl-N,N-bis(2-hydroxyethyl)-1-methylpyrazole-5-carboxamide.
| Compound Name | 3-(1,2,3,5,6,7-hexahydro-s-indacen-4-ylcarbamoylamino)sulfanyl-N,N-bis(2-hydroxyethyl)-1-methylpyrazole-5-carboxamide |
|---|---|
| PubChem CID | 142529476 |
| Molecular Formula | C22H29N5O4S |
| Molecular Weight | 459.57 g/mol |
| Exact Mass | 459.19 |
| IUPAC Name | 3-(1,2,3,5,6,7-hexahydro-s-indacen-4-ylcarbamoylamino)sulfanyl-N,N-bis(2-hydroxyethyl)-1-methylpyrazole-5-carboxamide |
| SMILES | Cn1nc(SNC(=O)Nc2c3c(cc4c2CCC4)CCC3)cc1C(=O)N(CCO)CCO |
| InChI | InChI=1S/C22H29N5O4S/c1-26-18(21(30)27(8-10-28)9-11-29)13-19(24-26)32-25-22(31)23-20-16-6-2-4-14(16)12-15-5-3-7-17(15)20/h12-13,28-29H,2-11H2,1H3,(H2,23,25,31) |
| InChIKey | VXUNNWKWLDZLBZ-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 119.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.57 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|