C18H17N5OS — CID 137404363
1-(3-cyanopyrazin-2-yl)sulfanyl-3-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)urea (PubChem CID 137404363) has the molecular formula C18H17N5OS and a molecular weight of 351.44 g/mol. Its IUPAC name is 1-(3-cyanopyrazin-2-yl)sulfanyl-3-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)urea.
| Compound Name | 1-(3-cyanopyrazin-2-yl)sulfanyl-3-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)urea |
|---|---|
| PubChem CID | 137404363 |
| Molecular Formula | C18H17N5OS |
| Molecular Weight | 351.44 g/mol |
| Exact Mass | 351.12 |
| IUPAC Name | 1-(3-cyanopyrazin-2-yl)sulfanyl-3-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)urea |
| SMILES | N#Cc1nccnc1SNC(=O)Nc1c2c(cc3c1CCC3)CCC2 |
| InChI | InChI=1S/C18H17N5OS/c19-10-15-17(21-8-7-20-15)25-23-18(24)22-16-13-5-1-3-11(13)9-12-4-2-6-14(12)16/h7-9H,1-6H2,(H2,22,23,24) |
| InChIKey | BFMBAISHCUXHAU-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.44 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|