C21H18N4O3S — CID 155431887
1-(5-cyano-1,3-dioxo-1,2-benzothiazol-1-yl)-3-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)urea (PubChem CID 155431887) has the molecular formula C21H18N4O3S and a molecular weight of 406.47 g/mol. Its IUPAC name is 1-(5-cyano-1,3-dioxo-1,2-benzothiazol-1-yl)-3-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)urea.
| Compound Name | 1-(5-cyano-1,3-dioxo-1,2-benzothiazol-1-yl)-3-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)urea |
|---|---|
| PubChem CID | 155431887 |
| Molecular Formula | C21H18N4O3S |
| Molecular Weight | 406.47 g/mol |
| Exact Mass | 406.11 |
| IUPAC Name | 1-(5-cyano-1,3-dioxo-1,2-benzothiazol-1-yl)-3-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)urea |
| SMILES | N#Cc1ccc2c(c1)C(=O)N=S2(=O)NC(=O)Nc1c2c(cc3c1CCC3)CCC2 |
| InChI | InChI=1S/C21H18N4O3S/c22-11-12-7-8-18-17(9-12)20(26)24-29(18,28)25-21(27)23-19-15-5-1-3-13(15)10-14-4-2-6-16(14)19/h7-10H,1-6H2,(H2,23,24,25,26,27,28) |
| InChIKey | LEXSDZYKTWCQAO-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 111.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.47 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |