C17H16N4O3S2 — CID 166042455
1-(1,3-dioxo-[1,3]thiazolo[4,5-d][1,2]thiazol-1-yl)-3-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)urea (PubChem CID 166042455) has the molecular formula C17H16N4O3S2 and a molecular weight of 388.47 g/mol. Its IUPAC name is 1-(1,3-dioxo-[1,3]thiazolo[4,5-d][1,2]thiazol-1-yl)-3-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)urea.
| Compound Name | 1-(1,3-dioxo-[1,3]thiazolo[4,5-d][1,2]thiazol-1-yl)-3-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)urea |
|---|---|
| PubChem CID | 166042455 |
| Molecular Formula | C17H16N4O3S2 |
| Molecular Weight | 388.47 g/mol |
| Exact Mass | 388.07 |
| IUPAC Name | 1-(1,3-dioxo-[1,3]thiazolo[4,5-d][1,2]thiazol-1-yl)-3-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)urea |
| SMILES | O=C(Nc1c2c(cc3c1CCC3)CCC2)NS1(=O)=NC(=O)c2ncsc21 |
| InChI | InChI=1S/C17H16N4O3S2/c22-15-14-16(25-8-18-14)26(24,20-15)21-17(23)19-13-11-5-1-3-9(11)7-10-4-2-6-12(10)13/h7-8H,1-6H2,(H2,19,20,21,22,23,24) |
| InChIKey | HKEFNIQCTRBZIL-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 100.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.47 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |