C19H18N2O3S2 — CID 167620710
2-(1,3-dioxothieno[2,3-d][1,2]thiazol-1-yl)-N-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)acetamide (PubChem CID 167620710) has the molecular formula C19H18N2O3S2 and a molecular weight of 386.50 g/mol. Its IUPAC name is 2-(1,3-dioxothieno[2,3-d][1,2]thiazol-1-yl)-N-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)acetamide.
| Compound Name | 2-(1,3-dioxothieno[2,3-d][1,2]thiazol-1-yl)-N-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)acetamide |
|---|---|
| PubChem CID | 167620710 |
| Molecular Formula | C19H18N2O3S2 |
| Molecular Weight | 386.50 g/mol |
| Exact Mass | 386.08 |
| IUPAC Name | 2-(1,3-dioxothieno[2,3-d][1,2]thiazol-1-yl)-N-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)acetamide |
| SMILES | O=C(CS1(=O)=NC(=O)c2sccc21)Nc1c2c(cc3c1CCC3)CCC2 |
| InChI | InChI=1S/C19H18N2O3S2/c22-16(10-26(24)15-7-8-25-18(15)19(23)21-26)20-17-13-5-1-3-11(13)9-12-4-2-6-14(12)17/h7-9H,1-6,10H2,(H,20,22) |
| InChIKey | PYCLCVYLDCHMHC-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 75.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.50 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |