C23H25N3O4S — CID 155431885
1-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)-3-[6-(2-hydroxypropan-2-yl)-1,3-dioxo-1,2-benzothiazol-1-yl]urea (PubChem CID 155431885) has the molecular formula C23H25N3O4S and a molecular weight of 439.54 g/mol. Its IUPAC name is 1-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)-3-[6-(2-hydroxypropan-2-yl)-1,3-dioxo-1,2-benzothiazol-1-yl]urea.
| Compound Name | 1-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)-3-[6-(2-hydroxypropan-2-yl)-1,3-dioxo-1,2-benzothiazol-1-yl]urea |
|---|---|
| PubChem CID | 155431885 |
| Molecular Formula | C23H25N3O4S |
| Molecular Weight | 439.54 g/mol |
| Exact Mass | 439.16 |
| IUPAC Name | 1-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)-3-[6-(2-hydroxypropan-2-yl)-1,3-dioxo-1,2-benzothiazol-1-yl]urea |
| SMILES | CC(C)(O)c1ccc2c(c1)S(=O)(NC(=O)Nc1c3c(cc4c1CCC4)CCC3)=NC2=O |
| InChI | InChI=1S/C23H25N3O4S/c1-23(2,29)15-9-10-18-19(12-15)31(30,25-21(18)27)26-22(28)24-20-16-7-3-5-13(16)11-14-6-4-8-17(14)20/h9-12,29H,3-8H2,1-2H3,(H2,24,25,26,27,28,30) |
| InChIKey | VLKBVLJNTONQME-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 107.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.54 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |