C19H19N3O2S2 — CID 158159369
N-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)-2-(N-isocyano-S-thiophen-2-ylsulfonimidoyl)acetamide (PubChem CID 158159369) has the molecular formula C19H19N3O2S2 and a molecular weight of 385.51 g/mol. Its IUPAC name is N-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)-2-(N-isocyano-S-thiophen-2-ylsulfonimidoyl)acetamide.
| Compound Name | N-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)-2-(N-isocyano-S-thiophen-2-ylsulfonimidoyl)acetamide |
|---|---|
| PubChem CID | 158159369 |
| Molecular Formula | C19H19N3O2S2 |
| Molecular Weight | 385.51 g/mol |
| Exact Mass | 385.09 |
| IUPAC Name | N-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)-2-(N-isocyano-S-thiophen-2-ylsulfonimidoyl)acetamide |
| SMILES | [C-]#[N+]N=S(=O)(CC(=O)Nc1c2c(cc3c1CCC3)CCC2)c1cccs1 |
| InChI | InChI=1S/C19H19N3O2S2/c1-20-22-26(24,18-9-4-10-25-18)12-17(23)21-19-15-7-2-5-13(15)11-14-6-3-8-16(14)19/h4,9-11H,2-3,5-8,12H2,(H,21,23) |
| InChIKey | FWBVBXXZJLVKEU-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 62.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.51 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|